C19H25NO — CID 162891167
1-piperidin-1-yltetradeca-2,4,6,10-tetraen-8-yn-1-one (PubChem CID 162891167) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is 1-piperidin-1-yltetradeca-2,4,6,10-tetraen-8-yn-1-one.
| Compound Name | 1-piperidin-1-yltetradeca-2,4,6,10-tetraen-8-yn-1-one |
|---|---|
| PubChem CID | 162891167 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 1-piperidin-1-yltetradeca-2,4,6,10-tetraen-8-yn-1-one |
| SMILES | CCCC=CC#CC=CC=CC=CC(=O)N1CCCCC1 |
| InChI | InChI=1S/C19H25NO/c1-2-3-4-5-6-7-8-9-10-11-13-16-19(21)20-17-14-12-15-18-20/h4-5,8-11,13,16H,2-3,12,14-15,17-18H2,1H3 |
| InChIKey | FXMWOIBPXOJROS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|