C29H33N3O3 — CID 162891897
(1S,3S,3aS,6aS)-1-benzyl-5-cycloheptyl-7'-ethylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 162891897) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is (1S,3S,3aS,6aS)-1-benzyl-5-cycloheptyl-7'-ethylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1S,3S,3aS,6aS)-1-benzyl-5-cycloheptyl-7'-ethylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 162891897 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | (1S,3S,3aS,6aS)-1-benzyl-5-cycloheptyl-7'-ethylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | CCc1cccc2c1NC(=O)[C@@]21N[C@@H](Cc2ccccc2)[C@H]2C(=O)N(C3CCCCCC3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C29H33N3O3/c1-2-19-13-10-16-21-25(19)30-28(35)29(21)24-23(22(31-29)17-18-11-6-5-7-12-18)26(33)32(27(24)34)20-14-8-3-4-9-15-20/h5-7,10-13,16,20,22-24,31H,2-4,8-9,14-15,17H2,1H3,(H,30,35)/t22-,23+,24+,29+/m0/s1 |
| InChIKey | ZZJFQBONDSFONH-CMSZEEODSA-N |
| XLogP | 3.93 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|