C27H28ClN3O3 — CID 4888154
1-benzyl-5'-chloro-5-cycloheptylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 4888154) has the molecular formula C27H28ClN3O3 and a molecular weight of 477.99 g/mol. Its IUPAC name is 1-benzyl-5'-chloro-5-cycloheptylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | 1-benzyl-5'-chloro-5-cycloheptylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 4888154 |
| Molecular Formula | C27H28ClN3O3 |
| Molecular Weight | 477.99 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 1-benzyl-5'-chloro-5-cycloheptylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | O=C1C2C(Cc3ccccc3)NC3(C(=O)Nc4ccc(Cl)cc43)C2C(=O)N1C1CCCCCC1 |
| InChI | InChI=1S/C27H28ClN3O3/c28-17-12-13-20-19(15-17)27(26(34)29-20)23-22(21(30-27)14-16-8-4-3-5-9-16)24(32)31(25(23)33)18-10-6-1-2-7-11-18/h3-5,8-9,12-13,15,18,21-23,30H,1-2,6-7,10-11,14H2,(H,29,34) |
| InChIKey | GUNBQMLEIIYJJG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.99 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|