C15H20 — CID 162893528
(1aS,7bS)-1,1,4,7-tetramethyl-1a,2,3,7b-tetrahydrocyclopropa[e]azulene (PubChem CID 162893528) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is (1aS,7bS)-1,1,4,7-tetramethyl-1a,2,3,7b-tetrahydrocyclopropa[e]azulene.
| Compound Name | (1aS,7bS)-1,1,4,7-tetramethyl-1a,2,3,7b-tetrahydrocyclopropa[e]azulene |
|---|---|
| PubChem CID | 162893528 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | (1aS,7bS)-1,1,4,7-tetramethyl-1a,2,3,7b-tetrahydrocyclopropa[e]azulene |
| SMILES | CC1=C2C(=C(C)CC[C@H]3[C@H]2C3(C)C)C=C1 |
| InChI | InChI=1S/C15H20/c1-9-6-8-12-14(15(12,3)4)13-10(2)5-7-11(9)13/h5,7,12,14H,6,8H2,1-4H3/t12-,14+/m0/s1 |
| InChIKey | DUHPRWZONNFGFL-GXTWGEPZSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |