C30H48O4 — CID 162894148
17-(5,6-dimethylhept-3-en-2-yl)-6-ethoxy-5,15-dihydroxy-10,13-dimethyl-2,4,6,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 162894148) has the molecular formula C30H48O4 and a molecular weight of 472.71 g/mol. Its IUPAC name is 17-(5,6-dimethylhept-3-en-2-yl)-6-ethoxy-5,15-dihydroxy-10,13-dimethyl-2,4,6,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 17-(5,6-dimethylhept-3-en-2-yl)-6-ethoxy-5,15-dihydroxy-10,13-dimethyl-2,4,6,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 162894148 |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | 17-(5,6-dimethylhept-3-en-2-yl)-6-ethoxy-5,15-dihydroxy-10,13-dimethyl-2,4,6,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CCOC1C=C2C3C(O)CC(C(C)C=CC(C)C(C)C)C3(C)CCC2C2(C)CCC(=O)CC12O |
| InChI | InChI=1S/C30H48O4/c1-8-34-26-15-22-23(29(7)14-11-21(31)17-30(26,29)33)12-13-28(6)24(16-25(32)27(22)28)20(5)10-9-19(4)18(2)3/h9-10,15,18-20,23-27,32-33H,8,11-14,16-17H2,1-7H3 |
| InChIKey | FPESVMYWFTWXKH-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|