C28H44O3 — CID 86083373
17-(5,6-dimethylhept-3-en-2-yl)-5,8-dihydroxy-10,13-dimethyl-1,2,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 86083373) has the molecular formula C28H44O3 and a molecular weight of 428.66 g/mol. Its IUPAC name is 17-(5,6-dimethylhept-3-en-2-yl)-5,8-dihydroxy-10,13-dimethyl-1,2,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 17-(5,6-dimethylhept-3-en-2-yl)-5,8-dihydroxy-10,13-dimethyl-1,2,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 86083373 |
| Molecular Formula | C28H44O3 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | 17-(5,6-dimethylhept-3-en-2-yl)-5,8-dihydroxy-10,13-dimethyl-1,2,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)C(C)C=CC(C)C1CCC2C3(O)C=CC4(O)CC(=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C28H44O3/c1-18(2)19(3)7-8-20(4)22-9-10-23-25(22,5)13-12-24-26(6)14-11-21(29)17-27(26,30)15-16-28(23,24)31/h7-8,15-16,18-20,22-24,30-31H,9-14,17H2,1-6H3 |
| InChIKey | ZDZNDZBTNXXUSC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|