C12H22O4 — CID 162894988
(2S,3R)-2,3-dihydroxydodecane-4,7-dione (PubChem CID 162894988) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is (2S,3R)-2,3-dihydroxydodecane-4,7-dione.
| Compound Name | (2S,3R)-2,3-dihydroxydodecane-4,7-dione |
|---|---|
| PubChem CID | 162894988 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (2S,3R)-2,3-dihydroxydodecane-4,7-dione |
| SMILES | CCCCCC(=O)CCC(=O)[C@H](O)[C@H](C)O |
| InChI | InChI=1S/C12H22O4/c1-3-4-5-6-10(14)7-8-11(15)12(16)9(2)13/h9,12-13,16H,3-8H2,1-2H3/t9-,12+/m0/s1 |
| InChIKey | DABGRVPOVJVANL-JOYOIKCWSA-N |
| XLogP | 1.23 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|