C22H16 — CID 162897285
(3R,4R)-3-hepta-1,3,5-triynyl-4-[(E)-non-1-en-3,5,7-triynyl]cyclohexene (PubChem CID 162897285) has the molecular formula C22H16 and a molecular weight of 280.37 g/mol. Its IUPAC name is (3R,4R)-3-hepta-1,3,5-triynyl-4-[(E)-non-1-en-3,5,7-triynyl]cyclohexene.
| Compound Name | (3R,4R)-3-hepta-1,3,5-triynyl-4-[(E)-non-1-en-3,5,7-triynyl]cyclohexene |
|---|---|
| PubChem CID | 162897285 |
| Molecular Formula | C22H16 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (3R,4R)-3-hepta-1,3,5-triynyl-4-[(E)-non-1-en-3,5,7-triynyl]cyclohexene |
| SMILES | CC#CC#CC#C/C=C/[C@H]1CCC=C[C@H]1C#CC#CC#CC |
| InChI | InChI=1S/C22H16/c1-3-5-7-9-10-12-14-18-22-20-16-15-19-21(22)17-13-11-8-6-4-2/h14-15,18-19,21-22H,16,20H2,1-2H3/b18-14+/t21-,22+/m1/s1 |
| InChIKey | ARWNPFLQSCRGQR-YKHCBAFFSA-N |
| XLogP | 3.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|