C26H31NO6 — CID 162897300
[(2S,4S,9aS)-4-(3-hydroxy-4-methoxyphenyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 162897300) has the molecular formula C26H31NO6 and a molecular weight of 453.54 g/mol. Its IUPAC name is [(2S,4S,9aS)-4-(3-hydroxy-4-methoxyphenyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | [(2S,4S,9aS)-4-(3-hydroxy-4-methoxyphenyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162897300 |
| Molecular Formula | C26H31NO6 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | [(2S,4S,9aS)-4-(3-hydroxy-4-methoxyphenyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc([C@@H]2C[C@@H](OC(=O)C=Cc3ccc(O)c(OC)c3)C[C@@H]3CCCCN32)cc1O |
| InChI | InChI=1S/C26H31NO6/c1-31-24-10-8-18(14-23(24)29)21-16-20(15-19-5-3-4-12-27(19)21)33-26(30)11-7-17-6-9-22(28)25(13-17)32-2/h6-11,13-14,19-21,28-29H,3-5,12,15-16H2,1-2H3/t19-,20-,21-/m0/s1 |
| InChIKey | JLPAPMHNWRDBBI-ACRUOGEOSA-N |
| XLogP | 4.43 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|