C25H36O8 — CID 162898791
(4R,4aR,5S,7S,8R,8aR)-7-hydroxy-7,8-dimethyl-5-[(2S)-2-methylbutanoyl]oxy-8-[2-(5-oxo-2H-furan-3-yl)ethyl]spiro[1,2,3,5,6,8a-hexahydronaphthalene-4,2'-oxirane]-4a-carboxylic acid (PubChem CID 162898791) has the molecular formula C25H36O8 and a molecular weight of 464.56 g/mol. Its IUPAC name is (4R,4aR,5S,7S,8R,8aR)-7-hydroxy-7,8-dimethyl-5-[(2S)-2-methylbutanoyl]oxy-8-[2-(5-oxo-2H-furan-3-yl)ethyl]spiro[1,2,3,5,6,8a-hexahydronaphthalene-4,2'-oxirane]-4a-carboxylic acid.
| Compound Name | (4R,4aR,5S,7S,8R,8aR)-7-hydroxy-7,8-dimethyl-5-[(2S)-2-methylbutanoyl]oxy-8-[2-(5-oxo-2H-furan-3-yl)ethyl]spiro[1,2,3,5,6,8a-hexahydronaphthalene-4,2'-oxirane]-4a-carboxylic acid |
|---|---|
| PubChem CID | 162898791 |
| Molecular Formula | C25H36O8 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | (4R,4aR,5S,7S,8R,8aR)-7-hydroxy-7,8-dimethyl-5-[(2S)-2-methylbutanoyl]oxy-8-[2-(5-oxo-2H-furan-3-yl)ethyl]spiro[1,2,3,5,6,8a-hexahydronaphthalene-4,2'-oxirane]-4a-carboxylic acid |
| SMILES | CC[C@H](C)C(=O)O[C@H]1C[C@](C)(O)[C@](C)(CCC2=CC(=O)OC2)[C@H]2CCC[C@]3(CO3)[C@]12C(=O)O |
| InChI | InChI=1S/C25H36O8/c1-5-15(2)20(27)33-18-12-23(4,30)22(3,10-8-16-11-19(26)31-13-16)17-7-6-9-24(14-32-24)25(17,18)21(28)29/h11,15,17-18,30H,5-10,12-14H2,1-4H3,(H,28,29)/t15-,17+,18-,22+,23-,24-,25-/m0/s1 |
| InChIKey | HLXRXKZVYFPPMX-DQFVWIRPSA-N |
| XLogP | 3.01 |
| TPSA | 122.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|