C15H24O — CID 162899953
7,10-dimethyl-3-prop-1-en-2-ylspiro[4.5]dec-6-en-8-ol (PubChem CID 162899953) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 7,10-dimethyl-3-prop-1-en-2-ylspiro[4.5]dec-6-en-8-ol.
| Compound Name | 7,10-dimethyl-3-prop-1-en-2-ylspiro[4.5]dec-6-en-8-ol |
|---|---|
| PubChem CID | 162899953 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 7,10-dimethyl-3-prop-1-en-2-ylspiro[4.5]dec-6-en-8-ol |
| SMILES | C=C(C)C1CCC2(C=C(C)C(O)CC2C)C1 |
| InChI | InChI=1S/C15H24O/c1-10(2)13-5-6-15(9-13)8-11(3)14(16)7-12(15)4/h8,12-14,16H,1,5-7,9H2,2-4H3 |
| InChIKey | KEJDOISIOSPWEF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|