C12H20S2 — CID 134986380
6-methyl-9-prop-1-en-2-yl-1,4-dithiaspiro[4.5]decane (PubChem CID 134986380) has the molecular formula C12H20S2 and a molecular weight of 228.43 g/mol. Its IUPAC name is 6-methyl-9-prop-1-en-2-yl-1,4-dithiaspiro[4.5]decane.
| Compound Name | 6-methyl-9-prop-1-en-2-yl-1,4-dithiaspiro[4.5]decane |
|---|---|
| PubChem CID | 134986380 |
| Molecular Formula | C12H20S2 |
| Molecular Weight | 228.43 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 6-methyl-9-prop-1-en-2-yl-1,4-dithiaspiro[4.5]decane |
| SMILES | C=C(C)C1CCC(C)C2(C1)SCCS2 |
| InChI | InChI=1S/C12H20S2/c1-9(2)11-5-4-10(3)12(8-11)13-6-7-14-12/h10-11H,1,4-8H2,2-3H3 |
| InChIKey | MAYDCKVXYRGPPZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|