C30H20O11 — CID 162900398
2-[2-[(2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydrochromen-6-yl]-4,5-dihydroxyphenyl]-5,7-dihydroxychromen-4-one (PubChem CID 162900398) has the molecular formula C30H20O11 and a molecular weight of 556.48 g/mol. Its IUPAC name is 2-[2-[(2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydrochromen-6-yl]-4,5-dihydroxyphenyl]-5,7-dihydroxychromen-4-one.
| Compound Name | 2-[2-[(2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydrochromen-6-yl]-4,5-dihydroxyphenyl]-5,7-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 162900398 |
| Molecular Formula | C30H20O11 |
| Molecular Weight | 556.48 g/mol |
| Exact Mass | 556.10 |
| IUPAC Name | 2-[2-[(2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydrochromen-6-yl]-4,5-dihydroxyphenyl]-5,7-dihydroxychromen-4-one |
| SMILES | O=C1C[C@@H](c2ccc(O)cc2)Oc2cc(O)c(-c3cc(O)c(O)cc3-c3cc(=O)c4c(O)cc(O)cc4o3)c(O)c21 |
| InChI | InChI=1S/C30H20O11/c31-13-3-1-12(2-4-13)23-9-22(38)29-26(40-23)11-20(36)27(30(29)39)16-8-18(34)17(33)7-15(16)24-10-21(37)28-19(35)5-14(32)6-25(28)41-24/h1-8,10-11,23,31-36,39H,9H2/t23-/m0/s1 |
| InChIKey | BHTPXPOXTZCVMS-QHCPKHFHSA-N |
| XLogP | 4.77 |
| TPSA | 198.12 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|