C32H51ClO3 — CID 162901061
[11-(chloromethyl)-9-hydroxy-4,4,6a,6b,8a,12,14b-heptamethyl-2,3,4a,5,6,6a,7,8,9,12,12a,13,14,14a-tetradecahydro-1H-picen-3-yl] acetate (PubChem CID 162901061) has the molecular formula C32H51ClO3 and a molecular weight of 519.21 g/mol. Its IUPAC name is [11-(chloromethyl)-9-hydroxy-4,4,6a,6b,8a,12,14b-heptamethyl-2,3,4a,5,6,6a,7,8,9,12,12a,13,14,14a-tetradecahydro-1H-picen-3-yl] acetate.
| Compound Name | [11-(chloromethyl)-9-hydroxy-4,4,6a,6b,8a,12,14b-heptamethyl-2,3,4a,5,6,6a,7,8,9,12,12a,13,14,14a-tetradecahydro-1H-picen-3-yl] acetate |
|---|---|
| PubChem CID | 162901061 |
| Molecular Formula | C32H51ClO3 |
| Molecular Weight | 519.21 g/mol |
| Exact Mass | 518.35 |
| IUPAC Name | [11-(chloromethyl)-9-hydroxy-4,4,6a,6b,8a,12,14b-heptamethyl-2,3,4a,5,6,6a,7,8,9,12,12a,13,14,14a-tetradecahydro-1H-picen-3-yl] acetate |
| SMILES | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4C(C)C(CCl)=CC(O)C4(C)CCC23C)C1(C)C |
| InChI | InChI=1S/C32H51ClO3/c1-19-21(18-33)17-25(35)30(6)15-16-31(7)22(27(19)30)9-10-24-29(5)13-12-26(36-20(2)34)28(3,4)23(29)11-14-32(24,31)8/h17,19,22-27,35H,9-16,18H2,1-8H3 |
| InChIKey | WLMOBFMSWMCZEY-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.21 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|