C19H17ClN2OS — CID 162901549
(4-chloro-1-benzothiophen-2-yl)-(2-pyridin-3-ylpiperidin-1-yl)methanone (PubChem CID 162901549) has the molecular formula C19H17ClN2OS and a molecular weight of 356.88 g/mol. Its IUPAC name is (4-chloro-1-benzothiophen-2-yl)-(2-pyridin-3-ylpiperidin-1-yl)methanone.
| Compound Name | (4-chloro-1-benzothiophen-2-yl)-(2-pyridin-3-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 162901549 |
| Molecular Formula | C19H17ClN2OS |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | (4-chloro-1-benzothiophen-2-yl)-(2-pyridin-3-ylpiperidin-1-yl)methanone |
| SMILES | O=C(c1cc2c(Cl)cccc2s1)N1CCCCC1c1cccnc1 |
| InChI | InChI=1S/C19H17ClN2OS/c20-15-6-3-8-17-14(15)11-18(24-17)19(23)22-10-2-1-7-16(22)13-5-4-9-21-12-13/h3-6,8-9,11-12,16H,1-2,7,10H2 |
| InChIKey | TZOFNJOBRFKMDR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |