C16H16ClN3O — CID 63658212
(2-amino-6-chlorophenyl)-(2-pyridin-3-ylpyrrolidin-1-yl)methanone (PubChem CID 63658212) has the molecular formula C16H16ClN3O and a molecular weight of 301.78 g/mol. Its IUPAC name is (2-amino-6-chlorophenyl)-(2-pyridin-3-ylpyrrolidin-1-yl)methanone.
| Compound Name | (2-amino-6-chlorophenyl)-(2-pyridin-3-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 63658212 |
| Molecular Formula | C16H16ClN3O |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | (2-amino-6-chlorophenyl)-(2-pyridin-3-ylpyrrolidin-1-yl)methanone |
| SMILES | Nc1cccc(Cl)c1C(=O)N1CCCC1c1cccnc1 |
| InChI | InChI=1S/C16H16ClN3O/c17-12-5-1-6-13(18)15(12)16(21)20-9-3-7-14(20)11-4-2-8-19-10-11/h1-2,4-6,8,10,14H,3,7,9,18H2 |
| InChIKey | URYAIWNHVUHNEX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|