C20H17ClN2O2 — CID 70780277
[5-(2-chlorophenyl)furan-2-yl]-(2-pyridin-3-ylpyrrolidin-1-yl)methanone (PubChem CID 70780277) has the molecular formula C20H17ClN2O2 and a molecular weight of 352.82 g/mol. Its IUPAC name is [5-(2-chlorophenyl)furan-2-yl]-(2-pyridin-3-ylpyrrolidin-1-yl)methanone.
| Compound Name | [5-(2-chlorophenyl)furan-2-yl]-(2-pyridin-3-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 70780277 |
| Molecular Formula | C20H17ClN2O2 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | [5-(2-chlorophenyl)furan-2-yl]-(2-pyridin-3-ylpyrrolidin-1-yl)methanone |
| SMILES | O=C(c1ccc(-c2ccccc2Cl)o1)N1CCCC1c1cccnc1 |
| InChI | InChI=1S/C20H17ClN2O2/c21-16-7-2-1-6-15(16)18-9-10-19(25-18)20(24)23-12-4-8-17(23)14-5-3-11-22-13-14/h1-3,5-7,9-11,13,17H,4,8,12H2 |
| InChIKey | RTRSWWPZEZYBGI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |