C34H50O9 — CID 162902013
19-but-1-enyl-15-hydroxy-7-(4-hydroxy-3,5-dimethoxy-6-methyloxan-2-yl)oxy-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-13,21-dione (PubChem CID 162902013) has the molecular formula C34H50O9 and a molecular weight of 602.77 g/mol. Its IUPAC name is 19-but-1-enyl-15-hydroxy-7-(4-hydroxy-3,5-dimethoxy-6-methyloxan-2-yl)oxy-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-13,21-dione.
| Compound Name | 19-but-1-enyl-15-hydroxy-7-(4-hydroxy-3,5-dimethoxy-6-methyloxan-2-yl)oxy-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-13,21-dione |
|---|---|
| PubChem CID | 162902013 |
| Molecular Formula | C34H50O9 |
| Molecular Weight | 602.77 g/mol |
| Exact Mass | 602.35 |
| IUPAC Name | 19-but-1-enyl-15-hydroxy-7-(4-hydroxy-3,5-dimethoxy-6-methyloxan-2-yl)oxy-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-13,21-dione |
| SMILES | CCC=CC1CCCC(O)C(C)C(=O)C2=CC3C(C=CC4CC(OC5OC(C)C(OC)C(O)C5OC)CC43)C2CC(=O)O1 |
| InChI | InChI=1S/C34H50O9/c1-6-7-9-21-10-8-11-28(35)18(2)30(37)27-16-25-23(26(27)17-29(36)42-21)13-12-20-14-22(15-24(20)25)43-34-33(40-5)31(38)32(39-4)19(3)41-34/h7,9,12-13,16,18-26,28,31-35,38H,6,8,10-11,14-15,17H2,1-5H3 |
| InChIKey | AWOCISVPXCEUEW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.77 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|