C10H18O3 — CID 162903140
(2R,3E,6E)-2,6-dimethylocta-3,6-diene-1,2,8-triol (PubChem CID 162903140) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (2R,3E,6E)-2,6-dimethylocta-3,6-diene-1,2,8-triol.
| Compound Name | (2R,3E,6E)-2,6-dimethylocta-3,6-diene-1,2,8-triol |
|---|---|
| PubChem CID | 162903140 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (2R,3E,6E)-2,6-dimethylocta-3,6-diene-1,2,8-triol |
| SMILES | C/C(=C\CO)C/C=C/[C@@](C)(O)CO |
| InChI | InChI=1S/C10H18O3/c1-9(5-7-11)4-3-6-10(2,13)8-12/h3,5-6,11-13H,4,7-8H2,1-2H3/b6-3+,9-5+/t10-/m1/s1 |
| InChIKey | IRUIGQKPFNFHOD-IFWDQZPZSA-N |
| XLogP | 0.61 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|