C21H20O6 — CID 162904198
5,12-dihydroxy-2,8,8,10-tetramethyl-1,2-dihydronaphtho[7,6-f]isochromene-4,9,11-trione (PubChem CID 162904198) has the molecular formula C21H20O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is 5,12-dihydroxy-2,8,8,10-tetramethyl-1,2-dihydronaphtho[7,6-f]isochromene-4,9,11-trione.
| Compound Name | 5,12-dihydroxy-2,8,8,10-tetramethyl-1,2-dihydronaphtho[7,6-f]isochromene-4,9,11-trione |
|---|---|
| PubChem CID | 162904198 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 5,12-dihydroxy-2,8,8,10-tetramethyl-1,2-dihydronaphtho[7,6-f]isochromene-4,9,11-trione |
| SMILES | CC1Cc2c(c(O)cc3cc4c(c(O)c23)C(=O)C(C)C(=O)C4(C)C)C(=O)O1 |
| InChI | InChI=1S/C21H20O6/c1-8-5-11-14-10(7-13(22)15(11)20(26)27-8)6-12-16(18(14)24)17(23)9(2)19(25)21(12,3)4/h6-9,22,24H,5H2,1-4H3 |
| InChIKey | VLWLCFZSWPLWOA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|