C22H20O7 — CID 90980319
5-methoxy-2,8,8,10-tetramethyl-1,2-dihydronaphtho[2,3-f]isochromene-4,7,9,11,12-pentone (PubChem CID 90980319) has the molecular formula C22H20O7 and a molecular weight of 396.40 g/mol. Its IUPAC name is 5-methoxy-2,8,8,10-tetramethyl-1,2-dihydronaphtho[2,3-f]isochromene-4,7,9,11,12-pentone.
| Compound Name | 5-methoxy-2,8,8,10-tetramethyl-1,2-dihydronaphtho[2,3-f]isochromene-4,7,9,11,12-pentone |
|---|---|
| PubChem CID | 90980319 |
| Molecular Formula | C22H20O7 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 5-methoxy-2,8,8,10-tetramethyl-1,2-dihydronaphtho[2,3-f]isochromene-4,7,9,11,12-pentone |
| SMILES | COc1cc2c(c3c1C(=O)OC(C)C3)C(=O)C1=C(C2=O)C(C)(C)C(=O)C(C)C1=O |
| InChI | InChI=1S/C22H20O7/c1-8-6-10-13-11(7-12(28-5)14(10)21(27)29-8)18(24)16-15(19(13)25)17(23)9(2)20(26)22(16,3)4/h7-9H,6H2,1-5H3 |
| InChIKey | ZSLCVRORTUPDLR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|