C11H12O3 — CID 5316661
(2R)-5-methoxy-2-methyl-2,3-dihydrochromen-4-one (PubChem CID 5316661) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is (2R)-5-methoxy-2-methyl-2,3-dihydrochromen-4-one.
| Compound Name | (2R)-5-methoxy-2-methyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 5316661 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (2R)-5-methoxy-2-methyl-2,3-dihydrochromen-4-one |
| SMILES | COc1cccc2c1C(=O)C[C@@H](C)O2 |
| InChI | InChI=1S/C11H12O3/c1-7-6-8(12)11-9(13-2)4-3-5-10(11)14-7/h3-5,7H,6H2,1-2H3/t7-/m1/s1 |
| InChIKey | XTAMLDAUJXMPMY-SSDOTTSWSA-N |
| XLogP | 2.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |