C16H20O5 — CID 162778589
ethyl 4-[(2S)-5-methoxy-4-oxo-2,3-dihydrochromen-2-yl]butanoate (PubChem CID 162778589) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is ethyl 4-[(2S)-5-methoxy-4-oxo-2,3-dihydrochromen-2-yl]butanoate.
| Compound Name | ethyl 4-[(2S)-5-methoxy-4-oxo-2,3-dihydrochromen-2-yl]butanoate |
|---|---|
| PubChem CID | 162778589 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | ethyl 4-[(2S)-5-methoxy-4-oxo-2,3-dihydrochromen-2-yl]butanoate |
| SMILES | CCOC(=O)CCC[C@H]1CC(=O)c2c(OC)cccc2O1 |
| InChI | InChI=1S/C16H20O5/c1-3-20-15(18)9-4-6-11-10-12(17)16-13(19-2)7-5-8-14(16)21-11/h5,7-8,11H,3-4,6,9-10H2,1-2H3/t11-/m0/s1 |
| InChIKey | GLMANIKADQSKED-NSHDSACASA-N |
| XLogP | 2.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |