C30H38O8 — CID 57228194
ethyl 4-[[2-[4-(4-acetyl-3-hydroxy-2-propylphenoxy)butyl]-4-oxo-2,3-dihydrochromen-7-yl]oxy]butanoate (PubChem CID 57228194) has the molecular formula C30H38O8 and a molecular weight of 526.63 g/mol. Its IUPAC name is ethyl 4-[[2-[4-(4-acetyl-3-hydroxy-2-propylphenoxy)butyl]-4-oxo-2,3-dihydrochromen-7-yl]oxy]butanoate.
| Compound Name | ethyl 4-[[2-[4-(4-acetyl-3-hydroxy-2-propylphenoxy)butyl]-4-oxo-2,3-dihydrochromen-7-yl]oxy]butanoate |
|---|---|
| PubChem CID | 57228194 |
| Molecular Formula | C30H38O8 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | ethyl 4-[[2-[4-(4-acetyl-3-hydroxy-2-propylphenoxy)butyl]-4-oxo-2,3-dihydrochromen-7-yl]oxy]butanoate |
| SMILES | CCCc1c(OCCCCC2CC(=O)c3ccc(OCCCC(=O)OCC)cc3O2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C30H38O8/c1-4-9-25-27(15-14-23(20(3)31)30(25)34)37-16-7-6-10-22-18-26(32)24-13-12-21(19-28(24)38-22)36-17-8-11-29(33)35-5-2/h12-15,19,22,34H,4-11,16-18H2,1-3H3 |
| InChIKey | WQTXHSWIZDPYRS-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|