C18H23NO3 — CID 162904270
(2R,4aS,9S,13bS)-2,9-dimethoxy-2,4a,5,6,8,9-hexahydro-1H-indolo[7a,1-a]isoquinolin-12-ol (PubChem CID 162904270) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is (2R,4aS,9S,13bS)-2,9-dimethoxy-2,4a,5,6,8,9-hexahydro-1H-indolo[7a,1-a]isoquinolin-12-ol.
| Compound Name | (2R,4aS,9S,13bS)-2,9-dimethoxy-2,4a,5,6,8,9-hexahydro-1H-indolo[7a,1-a]isoquinolin-12-ol |
|---|---|
| PubChem CID | 162904270 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | (2R,4aS,9S,13bS)-2,9-dimethoxy-2,4a,5,6,8,9-hexahydro-1H-indolo[7a,1-a]isoquinolin-12-ol |
| SMILES | CO[C@H]1C=C[C@@H]2CCN3C[C@@H](OC)c4ccc(O)cc4[C@]23C1 |
| InChI | InChI=1S/C18H23NO3/c1-21-14-5-3-12-7-8-19-11-17(22-2)15-6-4-13(20)9-16(15)18(12,19)10-14/h3-6,9,12,14,17,20H,7-8,10-11H2,1-2H3/t12-,14+,17-,18+/m1/s1 |
| InChIKey | NUUYSVVQANCQCR-OLUCIUBSSA-N |
| XLogP | 2.59 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|