C17H21NO2 — CID 162977979
(1R,15R,17S)-15-methoxy-10-azatetracyclo[8.6.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-4-ol (PubChem CID 162977979) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is (1R,15R,17S)-15-methoxy-10-azatetracyclo[8.6.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-4-ol.
| Compound Name | (1R,15R,17S)-15-methoxy-10-azatetracyclo[8.6.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-4-ol |
|---|---|
| PubChem CID | 162977979 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (1R,15R,17S)-15-methoxy-10-azatetracyclo[8.6.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-4-ol |
| SMILES | CO[C@H]1C=C2CCN3CCc4ccc(O)cc4[C@@H](C1)[C@@H]23 |
| InChI | InChI=1S/C17H21NO2/c1-20-14-8-12-5-7-18-6-4-11-2-3-13(19)9-15(11)16(10-14)17(12)18/h2-3,8-9,14,16-17,19H,4-7,10H2,1H3/t14-,16+,17+/m0/s1 |
| InChIKey | UIMPDKMBSQVICT-USXIJHARSA-N |
| XLogP | 2.45 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|