C13H22O7 — CID 162905510
(2S,3S,4R,5S,6R)-4-methoxy-2-methyl-6-[[(1S,2S,4R,6R)-2-methyl-3,7-dioxabicyclo[4.1.0]heptan-4-yl]oxy]oxane-3,5-diol (PubChem CID 162905510) has the molecular formula C13H22O7 and a molecular weight of 290.31 g/mol. Its IUPAC name is (2S,3S,4R,5S,6R)-4-methoxy-2-methyl-6-[[(1S,2S,4R,6R)-2-methyl-3,7-dioxabicyclo[4.1.0]heptan-4-yl]oxy]oxane-3,5-diol.
| Compound Name | (2S,3S,4R,5S,6R)-4-methoxy-2-methyl-6-[[(1S,2S,4R,6R)-2-methyl-3,7-dioxabicyclo[4.1.0]heptan-4-yl]oxy]oxane-3,5-diol |
|---|---|
| PubChem CID | 162905510 |
| Molecular Formula | C13H22O7 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | (2S,3S,4R,5S,6R)-4-methoxy-2-methyl-6-[[(1S,2S,4R,6R)-2-methyl-3,7-dioxabicyclo[4.1.0]heptan-4-yl]oxy]oxane-3,5-diol |
| SMILES | CO[C@H]1[C@H](O)[C@@H](O[C@@H]2C[C@H]3O[C@H]3[C@H](C)O2)O[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C13H22O7/c1-5-9(14)12(16-3)10(15)13(18-5)20-8-4-7-11(19-7)6(2)17-8/h5-15H,4H2,1-3H3/t5-,6-,7+,8+,9-,10-,11-,12+,13+/m0/s1 |
| InChIKey | OVDCUTOSMAARTN-MGEFLRKRSA-N |
| XLogP | -0.61 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|