C15H24O3 — CID 162907181
(5R)-5-methyl-5-[(E,3S)-6-oxo-3-propan-2-ylhept-1-enyl]oxolan-2-one (PubChem CID 162907181) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (5R)-5-methyl-5-[(E,3S)-6-oxo-3-propan-2-ylhept-1-enyl]oxolan-2-one.
| Compound Name | (5R)-5-methyl-5-[(E,3S)-6-oxo-3-propan-2-ylhept-1-enyl]oxolan-2-one |
|---|---|
| PubChem CID | 162907181 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (5R)-5-methyl-5-[(E,3S)-6-oxo-3-propan-2-ylhept-1-enyl]oxolan-2-one |
| SMILES | CC(=O)CC[C@H](/C=C/[C@@]1(C)CCC(=O)O1)C(C)C |
| InChI | InChI=1S/C15H24O3/c1-11(2)13(6-5-12(3)16)7-9-15(4)10-8-14(17)18-15/h7,9,11,13H,5-6,8,10H2,1-4H3/b9-7+/t13-,15+/m1/s1 |
| InChIKey | VNIPCLUJYQFEPB-GMTGPXDGSA-N |
| XLogP | 3.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|