C19H16O6 — CID 162907404
[(E,12S)-12,13-diacetyloxytridec-2-en-4,6,8,10-tetraynyl] acetate (PubChem CID 162907404) has the molecular formula C19H16O6 and a molecular weight of 340.33 g/mol. Its IUPAC name is [(E,12S)-12,13-diacetyloxytridec-2-en-4,6,8,10-tetraynyl] acetate.
| Compound Name | [(E,12S)-12,13-diacetyloxytridec-2-en-4,6,8,10-tetraynyl] acetate |
|---|---|
| PubChem CID | 162907404 |
| Molecular Formula | C19H16O6 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | [(E,12S)-12,13-diacetyloxytridec-2-en-4,6,8,10-tetraynyl] acetate |
| SMILES | CC(=O)OC/C=C/C#CC#CC#CC#C[C@@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C19H16O6/c1-16(20)23-14-12-10-8-6-4-5-7-9-11-13-19(25-18(3)22)15-24-17(2)21/h10,12,19H,14-15H2,1-3H3/b12-10+/t19-/m0/s1 |
| InChIKey | OLXJPSQTGFDEJN-RDELFYGPSA-N |
| XLogP | 0.61 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|