C58H84O3 — CID 162907499
[2,6,10,14,19,23-hexamethyl-3-oxo-25-(2,6,6-trimethylcyclohexen-1-yl)pentacosa-4,6,8,10,12,14,16,18,20,22,24-undecaen-2-yl] octadeca-9,12-dienoate (PubChem CID 162907499) has the molecular formula C58H84O3 and a molecular weight of 829.31 g/mol. Its IUPAC name is [2,6,10,14,19,23-hexamethyl-3-oxo-25-(2,6,6-trimethylcyclohexen-1-yl)pentacosa-4,6,8,10,12,14,16,18,20,22,24-undecaen-2-yl] octadeca-9,12-dienoate.
| Compound Name | [2,6,10,14,19,23-hexamethyl-3-oxo-25-(2,6,6-trimethylcyclohexen-1-yl)pentacosa-4,6,8,10,12,14,16,18,20,22,24-undecaen-2-yl] octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 162907499 |
| Molecular Formula | C58H84O3 |
| Molecular Weight | 829.31 g/mol |
| Exact Mass | 828.64 |
| IUPAC Name | [2,6,10,14,19,23-hexamethyl-3-oxo-25-(2,6,6-trimethylcyclohexen-1-yl)pentacosa-4,6,8,10,12,14,16,18,20,22,24-undecaen-2-yl] octadeca-9,12-dienoate |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OC(C)(C)C(=O)C=CC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C58H84O3/c1-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-42-56(60)61-58(10,11)55(59)46-44-52(6)40-31-38-50(4)37-29-35-48(2)33-27-28-34-49(3)36-30-39-51(5)43-45-54-53(7)41-32-47-57(54,8)9/h16-17,19-20,27-31,33-40,43-46H,12-15,18,21-26,32,41-42,47H2,1-11H3 |
| InChIKey | FIAJLFFCWGLUBZ-UHFFFAOYSA-N |
| XLogP | 17.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.31 |
| LogP ≤ 5 | 17.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|