C31H50O2 — CID 162907525
7-methoxy-4,4,9,13,14-pentamethyl-17-(6-methylhepta-4,6-dien-2-yl)-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 162907525) has the molecular formula C31H50O2 and a molecular weight of 454.74 g/mol. Its IUPAC name is 7-methoxy-4,4,9,13,14-pentamethyl-17-(6-methylhepta-4,6-dien-2-yl)-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | 7-methoxy-4,4,9,13,14-pentamethyl-17-(6-methylhepta-4,6-dien-2-yl)-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 162907525 |
| Molecular Formula | C31H50O2 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.38 |
| IUPAC Name | 7-methoxy-4,4,9,13,14-pentamethyl-17-(6-methylhepta-4,6-dien-2-yl)-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C=C(C)C=CCC(C)C1CCC2(C)C3C(OC)C=C4C(CCC(O)C4(C)C)C3(C)CCC12C |
| InChI | InChI=1S/C31H50O2/c1-20(2)11-10-12-21(3)22-15-16-31(8)27-25(33-9)19-24-23(13-14-26(32)28(24,4)5)29(27,6)17-18-30(22,31)7/h10-11,19,21-23,25-27,32H,1,12-18H2,2-9H3 |
| InChIKey | ONNBZMBJXFOFOY-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|