C37H62O9 — CID 73241661
2-[5-hydroxy-6-(3-hydroxy-7-methoxy-4,4,9,13,14-pentamethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhept-2-en-4-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 73241661) has the molecular formula C37H62O9 and a molecular weight of 650.89 g/mol. Its IUPAC name is 2-[5-hydroxy-6-(3-hydroxy-7-methoxy-4,4,9,13,14-pentamethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhept-2-en-4-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[5-hydroxy-6-(3-hydroxy-7-methoxy-4,4,9,13,14-pentamethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhept-2-en-4-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 73241661 |
| Molecular Formula | C37H62O9 |
| Molecular Weight | 650.89 g/mol |
| Exact Mass | 650.44 |
| IUPAC Name | 2-[5-hydroxy-6-(3-hydroxy-7-methoxy-4,4,9,13,14-pentamethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhept-2-en-4-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | COC1C=C2C(CCC(O)C2(C)C)C2(C)CCC3(C)C(C(C)C(O)C(C=C(C)C)OC4OC(CO)C(O)C(O)C4O)CCC3(C)C12 |
| InChI | InChI=1S/C37H62O9/c1-19(2)16-24(45-33-31(43)30(42)29(41)26(18-38)46-33)28(40)20(3)21-12-13-37(8)32-25(44-9)17-23-22(10-11-27(39)34(23,4)5)35(32,6)14-15-36(21,37)7/h16-17,20-22,24-33,38-43H,10-15,18H2,1-9H3 |
| InChIKey | FHEJVLFYFWDFDA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.89 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|