C10H18O2 — CID 162908416
(3R,4R)-3-ethenyl-2,5-dimethylhex-5-ene-2,4-diol (PubChem CID 162908416) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (3R,4R)-3-ethenyl-2,5-dimethylhex-5-ene-2,4-diol.
| Compound Name | (3R,4R)-3-ethenyl-2,5-dimethylhex-5-ene-2,4-diol |
|---|---|
| PubChem CID | 162908416 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (3R,4R)-3-ethenyl-2,5-dimethylhex-5-ene-2,4-diol |
| SMILES | C=C[C@H]([C@@H](O)C(=C)C)C(C)(C)O |
| InChI | InChI=1S/C10H18O2/c1-6-8(10(4,5)12)9(11)7(2)3/h6,8-9,11-12H,1-2H2,3-5H3/t8-,9+/m1/s1 |
| InChIKey | MNNUMABXOYEVSY-BDAKNGLRSA-N |
| XLogP | 1.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|