C10H18O3 — CID 10058252
(3S,4R)-3-ethenyl-4-hydroperoxy-2,5-dimethylhex-5-en-2-ol (PubChem CID 10058252) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (3S,4R)-3-ethenyl-4-hydroperoxy-2,5-dimethylhex-5-en-2-ol.
| Compound Name | (3S,4R)-3-ethenyl-4-hydroperoxy-2,5-dimethylhex-5-en-2-ol |
|---|---|
| PubChem CID | 10058252 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (3S,4R)-3-ethenyl-4-hydroperoxy-2,5-dimethylhex-5-en-2-ol |
| SMILES | C=C[C@@H]([C@@H](OO)C(=C)C)C(C)(C)O |
| InChI | InChI=1S/C10H18O3/c1-6-8(10(4,5)11)9(13-12)7(2)3/h6,8-9,11-12H,1-2H2,3-5H3/t8-,9-/m0/s1 |
| InChIKey | UDPIGLZSLDOMRW-IUCAKERBSA-N |
| XLogP | 1.99 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|