C10H18O2 — CID 15148730
3,4-bis(ethenyl)hexane-2,5-diol (PubChem CID 15148730) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 3,4-bis(ethenyl)hexane-2,5-diol.
| Compound Name | 3,4-bis(ethenyl)hexane-2,5-diol |
|---|---|
| PubChem CID | 15148730 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 3,4-bis(ethenyl)hexane-2,5-diol |
| SMILES | C=CC(C(C)O)C(C=C)C(C)O |
| InChI | InChI=1S/C10H18O2/c1-5-9(7(3)11)10(6-2)8(4)12/h5-12H,1-2H2,3-4H3 |
| InChIKey | BMTSPMYEFRIYMQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|