C19H22O7 — CID 162909148
[(1S,3S,7R,8S,13R,15S)-15-hydroxy-6-methylidene-5-oxo-4,14,16-trioxatetracyclo[8.4.3.01,13.03,7]heptadec-9-en-8-yl] 2-methylprop-2-enoate (PubChem CID 162909148) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is [(1S,3S,7R,8S,13R,15S)-15-hydroxy-6-methylidene-5-oxo-4,14,16-trioxatetracyclo[8.4.3.01,13.03,7]heptadec-9-en-8-yl] 2-methylprop-2-enoate.
| Compound Name | [(1S,3S,7R,8S,13R,15S)-15-hydroxy-6-methylidene-5-oxo-4,14,16-trioxatetracyclo[8.4.3.01,13.03,7]heptadec-9-en-8-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 162909148 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | [(1S,3S,7R,8S,13R,15S)-15-hydroxy-6-methylidene-5-oxo-4,14,16-trioxatetracyclo[8.4.3.01,13.03,7]heptadec-9-en-8-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[C@H]1C=C2CC[C@H]3O[C@]3(C[C@@H]3OC(=O)C(=C)[C@@H]13)[C@@H](O)OC2 |
| InChI | InChI=1S/C19H22O7/c1-9(2)16(20)24-12-6-11-4-5-14-19(26-14,18(22)23-8-11)7-13-15(12)10(3)17(21)25-13/h6,12-15,18,22H,1,3-5,7-8H2,2H3/t12-,13-,14+,15-,18-,19-/m0/s1 |
| InChIKey | JESBWCSVEJQENS-WREGWWGESA-N |
| XLogP | 1.17 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|