C20H22O7 — CID 162993631
[(1R,3S,7R,8R,9Z)-1,10-dimethyl-6-methylidene-5,13-dioxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-9,11-dien-8-yl] (3R)-3-hydroxy-2-methylidenebutanoate (PubChem CID 162993631) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is [(1R,3S,7R,8R,9Z)-1,10-dimethyl-6-methylidene-5,13-dioxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-9,11-dien-8-yl] (3R)-3-hydroxy-2-methylidenebutanoate.
| Compound Name | [(1R,3S,7R,8R,9Z)-1,10-dimethyl-6-methylidene-5,13-dioxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-9,11-dien-8-yl] (3R)-3-hydroxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 162993631 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | [(1R,3S,7R,8R,9Z)-1,10-dimethyl-6-methylidene-5,13-dioxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-9,11-dien-8-yl] (3R)-3-hydroxy-2-methylidenebutanoate |
| SMILES | C=C1C(=O)O[C@H]2C[C@@]3(C)OC(=CC3=O)/C(C)=C\[C@@H](OC(=O)C(=C)[C@@H](C)O)[C@H]12 |
| InChI | InChI=1S/C20H22O7/c1-9-6-14(25-18(23)10(2)12(4)21)17-11(3)19(24)26-15(17)8-20(5)16(22)7-13(9)27-20/h6-7,12,14-15,17,21H,2-3,8H2,1,4-5H3/b9-6-/t12-,14-,15+,17+,20-/m1/s1 |
| InChIKey | IIUNTHCAPVZAJW-YKJCPWKQSA-N |
| XLogP | 1.52 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|