C19H20O8 — CID 162848300
methyl 2-[[(1R,3S,7R,8S,9Z)-10-(hydroxymethyl)-1-methyl-6-methylidene-5,13-dioxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-9,11-dien-8-yl]oxy]prop-2-enoate (PubChem CID 162848300) has the molecular formula C19H20O8 and a molecular weight of 376.36 g/mol. Its IUPAC name is methyl 2-[[(1R,3S,7R,8S,9Z)-10-(hydroxymethyl)-1-methyl-6-methylidene-5,13-dioxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-9,11-dien-8-yl]oxy]prop-2-enoate.
| Compound Name | methyl 2-[[(1R,3S,7R,8S,9Z)-10-(hydroxymethyl)-1-methyl-6-methylidene-5,13-dioxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-9,11-dien-8-yl]oxy]prop-2-enoate |
|---|---|
| PubChem CID | 162848300 |
| Molecular Formula | C19H20O8 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | methyl 2-[[(1R,3S,7R,8S,9Z)-10-(hydroxymethyl)-1-methyl-6-methylidene-5,13-dioxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-9,11-dien-8-yl]oxy]prop-2-enoate |
| SMILES | C=C(O[C@H]1/C=C(/CO)C2=CC(=O)[C@@](C)(C[C@@H]3OC(=O)C(=C)[C@@H]13)O2)C(=O)OC |
| InChI | InChI=1S/C19H20O8/c1-9-16-13(25-10(2)18(23)24-4)5-11(8-20)12-6-15(21)19(3,27-12)7-14(16)26-17(9)22/h5-6,13-14,16,20H,1-2,7-8H2,3-4H3/b11-5-/t13-,14-,16-,19+/m0/s1 |
| InChIKey | CXAAAQLJZJSLPB-RPKZKWDZSA-N |
| XLogP | 0.72 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|