C19H20O6 — CID 162949017
(2Z,4S,8S,9S,11R)-2-(hydroxymethyl)-11-methyl-7-methylidene-9-(2-methylprop-2-enoyl)-5,14-dioxatricyclo[9.2.1.04,8]tetradeca-1(13),2-diene-6,12-dione (PubChem CID 162949017) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is (2Z,4S,8S,9S,11R)-2-(hydroxymethyl)-11-methyl-7-methylidene-9-(2-methylprop-2-enoyl)-5,14-dioxatricyclo[9.2.1.04,8]tetradeca-1(13),2-diene-6,12-dione.
| Compound Name | (2Z,4S,8S,9S,11R)-2-(hydroxymethyl)-11-methyl-7-methylidene-9-(2-methylprop-2-enoyl)-5,14-dioxatricyclo[9.2.1.04,8]tetradeca-1(13),2-diene-6,12-dione |
|---|---|
| PubChem CID | 162949017 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (2Z,4S,8S,9S,11R)-2-(hydroxymethyl)-11-methyl-7-methylidene-9-(2-methylprop-2-enoyl)-5,14-dioxatricyclo[9.2.1.04,8]tetradeca-1(13),2-diene-6,12-dione |
| SMILES | C=C(C)C(=O)[C@H]1C[C@@]2(C)OC(=CC2=O)/C(CO)=C\[C@@H]2OC(=O)C(=C)[C@@H]21 |
| InChI | InChI=1S/C19H20O6/c1-9(2)17(22)12-7-19(4)15(21)6-13(25-19)11(8-20)5-14-16(12)10(3)18(23)24-14/h5-6,12,14,16,20H,1,3,7-8H2,2,4H3/b11-5-/t12-,14-,16+,19+/m0/s1 |
| InChIKey | WPPJFAOGWLRIDB-IOMGKOHGSA-N |
| XLogP | 1.41 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|