C21H22O7 — CID 163055054
[8-(hydroxymethyl)-12-methyl-3-methylidene-4,11-dioxo-5,15-dioxatetracyclo[7.4.2.02,6.012,14]pentadeca-7,9-dien-14-yl] 2-methylbut-2-enoate (PubChem CID 163055054) has the molecular formula C21H22O7 and a molecular weight of 386.40 g/mol. Its IUPAC name is [8-(hydroxymethyl)-12-methyl-3-methylidene-4,11-dioxo-5,15-dioxatetracyclo[7.4.2.02,6.012,14]pentadeca-7,9-dien-14-yl] 2-methylbut-2-enoate.
| Compound Name | [8-(hydroxymethyl)-12-methyl-3-methylidene-4,11-dioxo-5,15-dioxatetracyclo[7.4.2.02,6.012,14]pentadeca-7,9-dien-14-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163055054 |
| Molecular Formula | C21H22O7 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | [8-(hydroxymethyl)-12-methyl-3-methylidene-4,11-dioxo-5,15-dioxatetracyclo[7.4.2.02,6.012,14]pentadeca-7,9-dien-14-yl] 2-methylbut-2-enoate |
| SMILES | C=C1C(=O)OC2C=C(CO)C3=CC(=O)C4(C)CC(C12)C4(OC(=O)C(C)=CC)O3 |
| InChI | InChI=1S/C21H22O7/c1-5-10(2)18(24)28-21-13-8-20(21,4)16(23)7-14(27-21)12(9-22)6-15-17(13)11(3)19(25)26-15/h5-7,13,15,17,22H,3,8-9H2,1-2,4H3 |
| InChIKey | OZPUPAMTCISIIA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|