C30H44O4 — CID 162909437
(1S,5S,7S,8R)-4-hydroxy-8-methyl-5,7-bis(3-methylbut-2-enyl)-8-(4-methylpent-3-enyl)-1-(2-methylpropanoyl)bicyclo[3.3.1]non-3-ene-2,9-dione (PubChem CID 162909437) has the molecular formula C30H44O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is (1S,5S,7S,8R)-4-hydroxy-8-methyl-5,7-bis(3-methylbut-2-enyl)-8-(4-methylpent-3-enyl)-1-(2-methylpropanoyl)bicyclo[3.3.1]non-3-ene-2,9-dione.
| Compound Name | (1S,5S,7S,8R)-4-hydroxy-8-methyl-5,7-bis(3-methylbut-2-enyl)-8-(4-methylpent-3-enyl)-1-(2-methylpropanoyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
|---|---|
| PubChem CID | 162909437 |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | (1S,5S,7S,8R)-4-hydroxy-8-methyl-5,7-bis(3-methylbut-2-enyl)-8-(4-methylpent-3-enyl)-1-(2-methylpropanoyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
| SMILES | CC(C)=CCC[C@]1(C)[C@@H](CC=C(C)C)C[C@]2(CC=C(C)C)C(=O)[C@@]1(C(=O)C(C)C)C(=O)C=C2O |
| InChI | InChI=1S/C30H44O4/c1-19(2)11-10-15-28(9)23(13-12-20(3)4)18-29(16-14-21(5)6)24(31)17-25(32)30(28,27(29)34)26(33)22(7)8/h11-12,14,17,22-23,31H,10,13,15-16,18H2,1-9H3/t23-,28+,29-,30-/m0/s1 |
| InChIKey | RHKSFHIGXAOZKO-UUAGDVGUSA-N |
| XLogP | 7.26 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|