C22H34O5 — CID 162911633
[(1R,2S,4E,8S,9R,10R)-9-acetyloxy-1,5-dimethyl-8-propan-2-yl-11-oxabicyclo[8.1.0]undec-4-en-2-yl] (Z)-2-methylbut-2-enoate (PubChem CID 162911633) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is [(1R,2S,4E,8S,9R,10R)-9-acetyloxy-1,5-dimethyl-8-propan-2-yl-11-oxabicyclo[8.1.0]undec-4-en-2-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1R,2S,4E,8S,9R,10R)-9-acetyloxy-1,5-dimethyl-8-propan-2-yl-11-oxabicyclo[8.1.0]undec-4-en-2-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162911633 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | [(1R,2S,4E,8S,9R,10R)-9-acetyloxy-1,5-dimethyl-8-propan-2-yl-11-oxabicyclo[8.1.0]undec-4-en-2-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@H]1C/C=C(\C)CC[C@@H](C(C)C)[C@@H](OC(C)=O)[C@H]2O[C@]12C |
| InChI | InChI=1S/C22H34O5/c1-8-15(5)21(24)26-18-12-10-14(4)9-11-17(13(2)3)19(25-16(6)23)20-22(18,7)27-20/h8,10,13,17-20H,9,11-12H2,1-7H3/b14-10+,15-8-/t17-,18-,19+,20+,22+/m0/s1 |
| InChIKey | PIRBWKHZKPMBQG-KAKNDSOOSA-N |
| XLogP | 4.36 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|