C29H32O12 — CID 162912191
[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[[(1S,2R,6R)-3-methylidene-4,13-dioxo-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-7,11-dien-8-yl]methoxy]oxan-2-yl]methyl 2-(4-hydroxyphenyl)acetate (PubChem CID 162912191) has the molecular formula C29H32O12 and a molecular weight of 572.56 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[[(1S,2R,6R)-3-methylidene-4,13-dioxo-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-7,11-dien-8-yl]methoxy]oxan-2-yl]methyl 2-(4-hydroxyphenyl)acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[[(1S,2R,6R)-3-methylidene-4,13-dioxo-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-7,11-dien-8-yl]methoxy]oxan-2-yl]methyl 2-(4-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 162912191 |
| Molecular Formula | C29H32O12 |
| Molecular Weight | 572.56 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[[(1S,2R,6R)-3-methylidene-4,13-dioxo-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-7,11-dien-8-yl]methoxy]oxan-2-yl]methyl 2-(4-hydroxyphenyl)acetate |
| SMILES | C=C1C(=O)O[C@@H]2C=C(CO[C@@H]3O[C@H](COC(=O)Cc4ccc(O)cc4)[C@@H](O)[C@H](O)[C@H]3O)CCC=C3C[C@H](OC3=O)[C@@H]12 |
| InChI | InChI=1S/C29H32O12/c1-14-23-19(39-27(14)35)9-16(3-2-4-17-11-20(23)40-28(17)36)12-38-29-26(34)25(33)24(32)21(41-29)13-37-22(31)10-15-5-7-18(30)8-6-15/h4-9,19-21,23-26,29-30,32-34H,1-3,10-13H2/t19-,20+,21-,23+,24-,25+,26-,29-/m1/s1 |
| InChIKey | OKCHBIUSLHZRMY-GBLOLKPZSA-N |
| XLogP | 0.36 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.56 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|