C29H34O11 — CID 162996597
[6-[(6-formyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-10-yl)methoxy]-3,4,5-trihydroxyoxan-2-yl]methyl 2-(4-hydroxyphenyl)acetate (PubChem CID 162996597) has the molecular formula C29H34O11 and a molecular weight of 558.58 g/mol. Its IUPAC name is [6-[(6-formyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-10-yl)methoxy]-3,4,5-trihydroxyoxan-2-yl]methyl 2-(4-hydroxyphenyl)acetate.
| Compound Name | [6-[(6-formyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-10-yl)methoxy]-3,4,5-trihydroxyoxan-2-yl]methyl 2-(4-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 162996597 |
| Molecular Formula | C29H34O11 |
| Molecular Weight | 558.58 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | [6-[(6-formyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-10-yl)methoxy]-3,4,5-trihydroxyoxan-2-yl]methyl 2-(4-hydroxyphenyl)acetate |
| SMILES | C=C1C(=O)OC2C=C(COC3OC(COC(=O)Cc4ccc(O)cc4)C(O)C(O)C3O)CCC=C(C=O)CCC12 |
| InChI | InChI=1S/C29H34O11/c1-16-21-10-7-18(13-30)3-2-4-19(11-22(21)39-28(16)36)14-38-29-27(35)26(34)25(33)23(40-29)15-37-24(32)12-17-5-8-20(31)9-6-17/h3,5-6,8-9,11,13,21-23,25-27,29,31,33-35H,1-2,4,7,10,12,14-15H2 |
| InChIKey | XYJGDDXPSUNBGS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.58 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|