C28H40O7 — CID 162912966
(13,16-dihydroxy-1,7,11,15,19,19-hexamethyl-5-oxo-8,10-dioxapentacyclo[12.8.0.02,11.04,9.015,20]docosa-4(9),6-dien-18-yl) acetate (PubChem CID 162912966) has the molecular formula C28H40O7 and a molecular weight of 488.62 g/mol. Its IUPAC name is (13,16-dihydroxy-1,7,11,15,19,19-hexamethyl-5-oxo-8,10-dioxapentacyclo[12.8.0.02,11.04,9.015,20]docosa-4(9),6-dien-18-yl) acetate.
| Compound Name | (13,16-dihydroxy-1,7,11,15,19,19-hexamethyl-5-oxo-8,10-dioxapentacyclo[12.8.0.02,11.04,9.015,20]docosa-4(9),6-dien-18-yl) acetate |
|---|---|
| PubChem CID | 162912966 |
| Molecular Formula | C28H40O7 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | (13,16-dihydroxy-1,7,11,15,19,19-hexamethyl-5-oxo-8,10-dioxapentacyclo[12.8.0.02,11.04,9.015,20]docosa-4(9),6-dien-18-yl) acetate |
| SMILES | CC(=O)OC1CC(O)C2(C)C(CCC3(C)C4Cc5c(oc(C)cc5=O)OC4(C)CC(O)C32)C1(C)C |
| InChI | InChI=1S/C28H40O7/c1-14-10-17(30)16-11-20-26(5)9-8-19-25(3,4)22(34-15(2)29)12-21(32)28(19,7)23(26)18(31)13-27(20,6)35-24(16)33-14/h10,18-23,31-32H,8-9,11-13H2,1-7H3 |
| InChIKey | JAIMGPMKHPKLLV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |