C18H16N2O5 — CID 162913235
methyl 2-[[(2S)-2-methoxy-3-oxo-1H-indole-2-carbonyl]amino]benzoate (PubChem CID 162913235) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is methyl 2-[[(2S)-2-methoxy-3-oxo-1H-indole-2-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[(2S)-2-methoxy-3-oxo-1H-indole-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 162913235 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | methyl 2-[[(2S)-2-methoxy-3-oxo-1H-indole-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)[C@]1(OC)Nc2ccccc2C1=O |
| InChI | InChI=1S/C18H16N2O5/c1-24-16(22)12-8-4-5-9-13(12)19-17(23)18(25-2)15(21)11-7-3-6-10-14(11)20-18/h3-10,20H,1-2H3,(H,19,23)/t18-/m0/s1 |
| InChIKey | DWUUEFPETVAASH-SFHVURJKSA-N |
| XLogP | 2.06 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|