C28H43NO2 — CID 162913237
(1R,6aS,8S,10aS,12aR)-8-hydroxy-10a,12a-dimethyl-1-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,5,6,6a,7,8,9,10,11,12-decahydro-1H-naphtho[1,2-h]quinolin-3-one (PubChem CID 162913237) has the molecular formula C28H43NO2 and a molecular weight of 425.66 g/mol. Its IUPAC name is (1R,6aS,8S,10aS,12aR)-8-hydroxy-10a,12a-dimethyl-1-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,5,6,6a,7,8,9,10,11,12-decahydro-1H-naphtho[1,2-h]quinolin-3-one.
| Compound Name | (1R,6aS,8S,10aS,12aR)-8-hydroxy-10a,12a-dimethyl-1-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,5,6,6a,7,8,9,10,11,12-decahydro-1H-naphtho[1,2-h]quinolin-3-one |
|---|---|
| PubChem CID | 162913237 |
| Molecular Formula | C28H43NO2 |
| Molecular Weight | 425.66 g/mol |
| Exact Mass | 425.33 |
| IUPAC Name | (1R,6aS,8S,10aS,12aR)-8-hydroxy-10a,12a-dimethyl-1-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,5,6,6a,7,8,9,10,11,12-decahydro-1H-naphtho[1,2-h]quinolin-3-one |
| SMILES | C=C(CC[C@@H](C)[C@H]1CC(=O)N=C2C3=C(CC[C@@]21C)[C@@]1(C)CC[C@H](O)C[C@@H]1CC3)C(C)C |
| InChI | InChI=1S/C28H43NO2/c1-17(2)18(3)7-8-19(4)24-16-25(31)29-26-22-10-9-20-15-21(30)11-13-27(20,5)23(22)12-14-28(24,26)6/h17,19-21,24,30H,3,7-16H2,1-2,4-6H3/t19-,20+,21+,24-,27+,28-/m1/s1 |
| InChIKey | RWTVGINCWISNRO-DQUPTJRXSA-N |
| XLogP | 6.66 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.66 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|