C28H45NO3 — CID 162999943
(1R,6aS,8S,10aS,12aR)-10a,12a-dimethyl-1-[(2S)-6-methyl-5-methylideneheptan-2-yl]-2,5,6,6a,7,8,9,10,11,12-decahydro-1H-naphtho[1,2-h]quinoline-3,3,8-triol (PubChem CID 162999943) has the molecular formula C28H45NO3 and a molecular weight of 443.67 g/mol. Its IUPAC name is (1R,6aS,8S,10aS,12aR)-10a,12a-dimethyl-1-[(2S)-6-methyl-5-methylideneheptan-2-yl]-2,5,6,6a,7,8,9,10,11,12-decahydro-1H-naphtho[1,2-h]quinoline-3,3,8-triol.
| Compound Name | (1R,6aS,8S,10aS,12aR)-10a,12a-dimethyl-1-[(2S)-6-methyl-5-methylideneheptan-2-yl]-2,5,6,6a,7,8,9,10,11,12-decahydro-1H-naphtho[1,2-h]quinoline-3,3,8-triol |
|---|---|
| PubChem CID | 162999943 |
| Molecular Formula | C28H45NO3 |
| Molecular Weight | 443.67 g/mol |
| Exact Mass | 443.34 |
| IUPAC Name | (1R,6aS,8S,10aS,12aR)-10a,12a-dimethyl-1-[(2S)-6-methyl-5-methylideneheptan-2-yl]-2,5,6,6a,7,8,9,10,11,12-decahydro-1H-naphtho[1,2-h]quinoline-3,3,8-triol |
| SMILES | C=C(CC[C@H](C)[C@H]1CC(O)(O)N=C2C3=C(CC[C@@]21C)[C@@]1(C)CC[C@H](O)C[C@@H]1CC3)C(C)C |
| InChI | InChI=1S/C28H45NO3/c1-17(2)18(3)7-8-19(4)24-16-28(31,32)29-25-22-10-9-20-15-21(30)11-13-26(20,5)23(22)12-14-27(24,25)6/h17,19-21,24,30-32H,3,7-16H2,1-2,4-6H3/t19-,20-,21-,24+,26-,27+/m0/s1 |
| InChIKey | YVHRZITXBSARTE-QFLHOHNESA-N |
| XLogP | 5.77 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.67 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|