C38H46O8 — CID 162914073
dimethyl (2S,3R)-2,3-bis[5-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]butanedioate (PubChem CID 162914073) has the molecular formula C38H46O8 and a molecular weight of 630.78 g/mol. Its IUPAC name is dimethyl (2S,3R)-2,3-bis[5-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]butanedioate.
| Compound Name | dimethyl (2S,3R)-2,3-bis[5-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]butanedioate |
|---|---|
| PubChem CID | 162914073 |
| Molecular Formula | C38H46O8 |
| Molecular Weight | 630.78 g/mol |
| Exact Mass | 630.32 |
| IUPAC Name | dimethyl (2S,3R)-2,3-bis[5-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]butanedioate |
| SMILES | COC(=O)[C@H](C1=CC(=O)C=C(C/C=C(\C)CCC=C(C)C)C1=O)[C@@H](C(=O)OC)C1=CC(=O)C=C(C/C=C(\C)CCC=C(C)C)C1=O |
| InChI | InChI=1S/C38H46O8/c1-23(2)11-9-13-25(5)15-17-27-19-29(39)21-31(35(27)41)33(37(43)45-7)34(38(44)46-8)32-22-30(40)20-28(36(32)42)18-16-26(6)14-10-12-24(3)4/h11-12,15-16,19-22,33-34H,9-10,13-14,17-18H2,1-8H3/b25-15+,26-16+/t33-,34+ |
| InChIKey | HWCOBRZEMVYVFD-RAUNALAJSA-N |
| XLogP | 6.74 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.78 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|