C29H40O4 — CID 162888201
methyl 2-[(4R,4aS,8aS)-7-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methyl-4-(3-methylbut-2-enyl)-5,8-dioxo-4,8a-dihydro-1H-naphthalen-4a-yl]acetate (PubChem CID 162888201) has the molecular formula C29H40O4 and a molecular weight of 452.64 g/mol. Its IUPAC name is methyl 2-[(4R,4aS,8aS)-7-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methyl-4-(3-methylbut-2-enyl)-5,8-dioxo-4,8a-dihydro-1H-naphthalen-4a-yl]acetate.
| Compound Name | methyl 2-[(4R,4aS,8aS)-7-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methyl-4-(3-methylbut-2-enyl)-5,8-dioxo-4,8a-dihydro-1H-naphthalen-4a-yl]acetate |
|---|---|
| PubChem CID | 162888201 |
| Molecular Formula | C29H40O4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | methyl 2-[(4R,4aS,8aS)-7-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methyl-4-(3-methylbut-2-enyl)-5,8-dioxo-4,8a-dihydro-1H-naphthalen-4a-yl]acetate |
| SMILES | COC(=O)C[C@@]12C(=O)C=C(C/C=C(\C)CCC=C(C)C)C(=O)[C@H]1CC=C(C)[C@H]2CC=C(C)C |
| InChI | InChI=1S/C29H40O4/c1-19(2)9-8-10-21(5)12-14-23-17-26(30)29(18-27(31)33-7)24(15-11-20(3)4)22(6)13-16-25(29)28(23)32/h9,11-13,17,24-25H,8,10,14-16,18H2,1-7H3/b21-12+/t24-,25-,29+/m1/s1 |
| InChIKey | KQRHISQZMXFNKQ-ITPUKWAGSA-N |
| XLogP | 6.64 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|